Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13398 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-leucine |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rdikfprvljlmer-bqbzgakwsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 202.253 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6979]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-leucine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=202.253}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-13398
- common-name:
- l-alanyl-l-leucine
- smiles:
- cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
- inchi-key:
- rdikfprvljlmer-bqbzgakwsa-n
- molecular-weight:
- 202.253
