Difference between revisions of "TRNAPhe-wybutosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15667 == * common-name: ** 6-cis, 3-oxo-tridecenoyl-coa * smiles: ** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15667 ==
+
== Metabolite CPD-8078 ==
 
* common-name:
 
* common-name:
** 6-cis, 3-oxo-tridecenoyl-coa
+
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** fdxhxlpclxeysu-dxazuofzsa-j
+
** wsmybuvbfwdmec-sbpcighssa-n
 
* molecular-weight:
 
* molecular-weight:
** 971.802
+
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14774]]
+
* [[RXN-8309]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8299]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
+
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}
+
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
{{#set: molecular-weight=971.802}}
+
{{#set: molecular-weight=749.036}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-8078

  • common-name:
    • 1-18:3-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • wsmybuvbfwdmec-sbpcighssa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality