Difference between revisions of "TRNAPhe-wybutosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite CARBON-MONOXIDE == * common-name: ** carbon monoxide * smiles: ** [c-]#[o+] * inchi-key: ** ugfairiumavxcw-uhfffaoysa-n * molecular-weigh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8078 ==
+
== Metabolite CARBON-MONOXIDE ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
+
** carbon monoxide
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+
** [c-]#[o+]
 
* inchi-key:
 
* inchi-key:
** wsmybuvbfwdmec-sbpcighssa-n
+
** ugfairiumavxcw-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 749.036
+
** 28.01
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8309]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8299]]
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 +
* [[PYRIMSYN1-RXN]]
 +
* [[QUERCETIN-23-DIOXYGENASE-RXN]]
 +
* [[RXN-17523]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=carbon monoxide}}
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
+
{{#set: inchi-key=inchikey=ugfairiumavxcw-uhfffaoysa-n}}
{{#set: molecular-weight=749.036}}
+
{{#set: molecular-weight=28.01}}

Revision as of 08:31, 15 March 2021

Metabolite CARBON-MONOXIDE

  • common-name:
    • carbon monoxide
  • smiles:
    • [c-]#[o+]
  • inchi-key:
    • ugfairiumavxcw-uhfffaoysa-n
  • molecular-weight:
    • 28.01

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality