Difference between revisions of "TRNAPhe-wybutosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite tRNAPhe-wybutosine == * common-name: ** wybutosine37 in trnaphe == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-207 ==
+
== Metabolite tRNAPhe-wybutosine ==
 
* common-name:
 
* common-name:
** phenylacetyl-coa
+
** wybutosine37 in trnaphe
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** zigifdrjfzyeeq-cecatxlmsa-j
 
* molecular-weight:
 
** 881.637
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10821]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14520]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetyl-coa}}
+
{{#set: common-name=wybutosine37 in trnaphe}}
{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
 
{{#set: molecular-weight=881.637}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite tRNAPhe-wybutosine

  • common-name:
    • wybutosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality