Difference between revisions of "TRNAPhe-wybutosine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...")
(Created page with "Category:metabolite == Metabolite D-Glucopyranuronate == * common-name: ** d-glucopyranuronate == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-548 ==
+
== Metabolite D-Glucopyranuronate ==
 
* common-name:
 
* common-name:
** s-formylglutathione
+
** d-glucopyranuronate
* smiles:
 
** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** fhxagoicbfgebf-bqbzgakwsa-m
 
* molecular-weight:
 
** 334.323
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-276]]
 
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2962]]
+
* [[MYO-INOSITOL-OXYGENASE-RXN]]
* [[RXN0-276]]
+
* [[RXN-13605]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-formylglutathione}}
+
{{#set: common-name=d-glucopyranuronate}}
{{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}}
 
{{#set: molecular-weight=334.323}}
 

Revision as of 13:13, 14 January 2021

Metabolite D-Glucopyranuronate

  • common-name:
    • d-glucopyranuronate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality