Difference between revisions of "TRNAs-with-CCA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...") |
(Created page with "Category:metabolite == Metabolite S-CD-Apo-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-CD-Apo-SP-Complex == |
* common-name: | * common-name: | ||
| − | ** | + | ** an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14384]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite S-CD-Apo-SP-Complex
- common-name:
- an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an s-sulfanyl-[cysteine desulfurase]-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
