Difference between revisions of "TRNAs-with-CCA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...") |
(Created page with "Category:metabolite == Metabolite tRNAs-with-CCA == * common-name: ** a trna containing a 3' cca end == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNAs-with-CCA == |
* common-name: | * common-name: | ||
− | ** | + | ** a trna containing a 3' cca end |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[TRNA-CYTIDYLYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trna containing a 3' cca end}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite tRNAs-with-CCA
- common-name:
- a trna containing a 3' cca end