Difference between revisions of "TROPINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12199 == * common-name: ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)...")
(Created page with "Category:metabolite == Metabolite TROPINE == * common-name: ** tropine * smiles: ** c[n+]1(c2(ccc1cc(o)c2)) * inchi-key: ** cyhomwapjjpnmw-jigdxuljsa-o * molecular-weight:...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12199 ==
+
== Metabolite TROPINE ==
 
* common-name:
 
* common-name:
** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
+
** tropine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c[n+]1(c2(ccc1cc(o)c2))
 
* inchi-key:
 
* inchi-key:
** vddfxumtxcqmfm-ugdqnksbsa-j
+
** cyhomwapjjpnmw-jigdxuljsa-o
 
* molecular-weight:
 
* molecular-weight:
** 927.663
+
** 142.22
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11245]]
+
* [[TROPINE-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11244]]
+
* [[TROPINE-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}}
+
{{#set: common-name=tropine}}
{{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}}
+
{{#set: inchi-key=inchikey=cyhomwapjjpnmw-jigdxuljsa-o}}
{{#set: molecular-weight=927.663}}
+
{{#set: molecular-weight=142.22}}

Latest revision as of 11:12, 18 March 2021

Metabolite TROPINE

  • common-name:
    • tropine
  • smiles:
    • c[n+]1(c2(ccc1cc(o)c2))
  • inchi-key:
    • cyhomwapjjpnmw-jigdxuljsa-o
  • molecular-weight:
    • 142.22

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality