Difference between revisions of "TROPINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-myristoyl-ACPs == * common-name: ** a 3-oxo-myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9536 == React...") |
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-11674 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-hydroxytryptophol sulfate |
+ | * smiles: | ||
+ | ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) | ||
+ | * inchi-key: | ||
+ | ** focuajyuoxsnds-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 256.253 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-10782]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-hydroxytryptophol sulfate}} |
+ | {{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=256.253}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-11674
- common-name:
- 5-hydroxytryptophol sulfate
- smiles:
- c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
- inchi-key:
- focuajyuoxsnds-uhfffaoysa-m
- molecular-weight:
- 256.253