Difference between revisions of "TROPINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-myristoyl-ACPs == * common-name: ** a 3-oxo-myristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9536 == React...")
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-myristoyl-ACPs ==
+
== Metabolite CPD-11674 ==
 
* common-name:
 
* common-name:
** a 3-oxo-myristoyl-[acp]
+
** 5-hydroxytryptophol sulfate
 +
* smiles:
 +
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
 +
* inchi-key:
 +
** focuajyuoxsnds-uhfffaoysa-m
 +
* molecular-weight:
 +
** 256.253
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9536]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9535]]
+
* [[RXN-10782]]
* [[RXN-9653]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-myristoyl-[acp]}}
+
{{#set: common-name=5-hydroxytryptophol sulfate}}
 +
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
 +
{{#set: molecular-weight=256.253}}

Revision as of 15:29, 5 January 2021

Metabolite CPD-11674

  • common-name:
    • 5-hydroxytryptophol sulfate
  • smiles:
    • c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
  • inchi-key:
    • focuajyuoxsnds-uhfffaoysa-m
  • molecular-weight:
    • 256.253

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality