Difference between revisions of "TRP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17543 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dapdiamide e |
* smiles: | * smiles: | ||
| − | ** c([o-])(=o) | + | ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bqmjfercspvsgr-lhzzqdsxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 316.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16294]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16294]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dapdiamide e}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bqmjfercspvsgr-lhzzqdsxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=316.313}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-17543
- common-name:
- dapdiamide e
- smiles:
- cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- bqmjfercspvsgr-lhzzqdsxsa-n
- molecular-weight:
- 316.313
