Difference between revisions of "TRP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16099 RXN-16099] == * direction: ** left-to-right * common-name: ** icosadienoyl-lipid 8-desatu...")
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16099 RXN-16099] ==
+
== Metabolite TRP ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** icosadienoyl-lipid 8-desaturase
+
** l-tryptophan
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.4 ec-1.14.19.4]
+
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-17351]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-17283]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** qivbcdijiajpqs-vifpvbqesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00350]]
+
** 204.228
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
−
== Pathway(s) ==
+
* [[RXN-8665]]
−
* [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601]
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
−
== Reconstruction information  ==
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[biomass_rxn]]
−
== External links  ==
+
== Reaction(s) known to produce the compound ==
−
* RHEA:
+
* [[RXN0-2382]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=46793 46793]
+
* [[TRYPSYN-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
−
{{#set: common-name=icosadienoyl-lipid 8-desaturase}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: ec-number=ec-1.14.19.4}}
+
{{#set: common-name=l-tryptophan}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
−
{{#set: nb pathway associated=1}}
+
{{#set: molecular-weight=204.228}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite TRP

  • common-name:
    • l-tryptophan
  • smiles:
    • c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
  • inchi-key:
    • qivbcdijiajpqs-vifpvbqesa-n
  • molecular-weight:
    • 204.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRP&oldid=139616"