Difference between revisions of "TRP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-AMINO-LEVULINATE == * common-name: ** 5-aminolevulinate * smiles: ** c(c(c[n+])=o)cc([o-])=o * inchi-key: ** zgxjtsgniosylo-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TRP == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-tryptophan |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qivbcdijiajpqs-vifpvbqesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 204.228 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
| + | * [[RXN-8665]] | ||
| + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] | ||
| + | * [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]] | ||
| + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-2382]] |
| + | * [[TRYPSYN-RXN]] | ||
| + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-tryptophan}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=204.228}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TRP
- common-name:
- l-tryptophan
- smiles:
- c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
- inchi-key:
- qivbcdijiajpqs-vifpvbqesa-n
- molecular-weight:
- 204.228
Reaction(s) known to consume the compound
- AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN
- RXN-8665
- TRYPTOPHAN--TRNA-LIGASE-RXN
- TRYPTOPHAN-2-MONOOXYGENASE-RXN
- TRYPTOPHAN-AMINOTRANSFERASE-RXN
- biomass_rxn
