Difference between revisions of "TRP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=XMPXAN-RXN XMPXAN-RXN] == * direction: ** left-to-right * common-name: ** xmp phosphohydrolase ** 5...")
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=XMPXAN-RXN XMPXAN-RXN] ==
+
== Metabolite TRP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** xmp phosphohydrolase
+
** l-tryptophan
** 5'-nucleotidase
+
* smiles:
* ec-number:
+
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
** [http://enzyme.expasy.org/EC/3.1.3.5 ec-3.1.3.5]
+
* inchi-key:
== Reaction formula ==
+
** qivbcdijiajpqs-vifpvbqesa-n
* 1 [[WATER]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[XANTHOSINE]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 204.228
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ18402]]
+
* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
** Category: [[annotation]]
+
* [[RXN-8665]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
** Category: [[orthology]]
+
* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
* Gene: [[SJ18895]]
+
* [[biomass_rxn]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-2382]]
* Gene: [[SJ09030]]
+
* [[TRYPSYN-RXN]]
** Category: [[annotation]]
+
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ16098]]
+
{{#set: common-name=l-tryptophan}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=204.228}}
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ15366]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
 
** '''7''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-5695]], inosine 5'-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5695 PWY-5695]
 
** '''4''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28531 28531]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02719 R02719]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=xmp phosphohydrolase|5'-nucleotidase}}
 
{{#set: ec-number=ec-3.1.3.5}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite TRP

  • common-name:
    • l-tryptophan
  • smiles:
    • c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
  • inchi-key:
    • qivbcdijiajpqs-vifpvbqesa-n
  • molecular-weight:
    • 204.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality