Difference between revisions of "TRP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=XMPXAN-RXN XMPXAN-RXN] == * direction: ** left-to-right * common-name: ** xmp phosphohydrolase ** 5...") |
(Created page with "Category:metabolite == Metabolite TRP == * common-name: ** l-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-vifpvbqesa-n *...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite TRP == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** l-tryptophan |
− | + | * smiles: | |
− | * | + | ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) |
− | ** | + | * inchi-key: |
− | == | + | ** qivbcdijiajpqs-vifpvbqesa-n |
− | + | * molecular-weight: | |
− | = | + | ** 204.228 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] | |
− | + | * [[RXN-8665]] | |
− | ** | + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] |
− | * | + | * [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]] |
− | ** | + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] |
− | + | * [[biomass_rxn]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN0-2382]] |
− | + | * [[TRYPSYN-RXN]] | |
− | * | + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=l-tryptophan}} | |
− | * | + | {{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}} |
− | + | {{#set: molecular-weight=204.228}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | * | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TRP
- common-name:
- l-tryptophan
- smiles:
- c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
- inchi-key:
- qivbcdijiajpqs-vifpvbqesa-n
- molecular-weight:
- 204.228
Reaction(s) known to consume the compound
- AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN
- RXN-8665
- TRYPTOPHAN--TRNA-LIGASE-RXN
- TRYPTOPHAN-2-MONOOXYGENASE-RXN
- TRYPTOPHAN-AMINOTRANSFERASE-RXN
- biomass_rxn