Difference between revisions of "TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-190 == * common-name: ** n-acetyl-α-d-glucosaminyl-diphosphodolichol == Reaction(s) known to consume the compound == * 2.4.1....") |
(Created page with "Category:metabolite == Metabolite CPD-9857 == * common-name: ** 2-methoxy-6-(all-trans-heptaprenyl)phenol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9857 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-methoxy-6-(all-trans-heptaprenyl)phenol |
| + | * smiles: | ||
| + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** ywvpprxiddchcq-cuhbluqcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 600.966 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9225]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-(all-trans-heptaprenyl)phenol}} |
| + | {{#set: inchi-key=inchikey=ywvpprxiddchcq-cuhbluqcsa-n}} | ||
| + | {{#set: molecular-weight=600.966}} | ||
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-9857
- common-name:
- 2-methoxy-6-(all-trans-heptaprenyl)phenol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c
- inchi-key:
- ywvpprxiddchcq-cuhbluqcsa-n
- molecular-weight:
- 600.966
