Difference between revisions of "TRPCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] == * common-name: ** geranylgeranyl diphosphate * smiles:...")
(Created page with "Category:pathway == Pathway TRPCAT-PWY == * taxonomic-range: ** tax-2 * common-name: ** l-tryptophan degradation i (via anthranilate) == Reaction(s) found == * ARYLFORMA...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] ==
+
== Pathway TRPCAT-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** geranylgeranyl diphosphate
+
** l-tryptophan degradation i (via anthranilate)
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
* [[ARYLFORMAMIDASE-RXN]]
* inchi-key:
+
* [[RXN-8665]]
** oinneunvozhbox-qircyjposa-k
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneKYNURENINASE-RXN KYNURENINASE-RXN]
** 447.424
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-tryptophan degradation i (via anthranilate)}}
* [[2.5.1.32-RXN]]
+
{{#set: nb reaction found=2}}
* [[2.5.1.41-RXN]]
+
{{#set: completion rate=0.67}}
* [[2.5.1.42-RXN]]
+
{{#set: nb total reaction=3}}
* [[RXN-10625]]
 
* [[RXN-11486]]
 
* [[RXN-11488]]
 
* [[RXN-13323]]
 
* [[RXN-14929]]
 
* [[RXN-17480]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7663]]
 
* [[RXN-7673]]
 
* [[RXN-8788]]
 
== Reaction(s) known to produce the compound ==
 
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 
* [[GGPS]]
 
* [[RXN-3701]]
 
* [[RXN-7658]]
 
* [[RXN-7673]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=geranylgeranyl diphosphate}}
 
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
 
{{#set: molecular-weight=447.424}}
 

Latest revision as of 11:00, 18 March 2021

Pathway TRPCAT-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-tryptophan degradation i (via anthranilate)

Reaction(s) found

Reaction(s) not found

  • [NoneKYNURENINASE-RXN KYNURENINASE-RXN]