Difference between revisions of "TRPCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] == * common-name: ** geranylgeranyl diphosphate * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
+
** geranylgeranyl diphosphate
 
* smiles:
 
* smiles:
** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** pfmvormcvgoqkr-xncokrrhsa-k
+
** oinneunvozhbox-qircyjposa-k
 
* molecular-weight:
 
* molecular-weight:
** 1146.922
+
** 447.424
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8975]]
+
* [[2.5.1.32-RXN]]
 +
* [[2.5.1.41-RXN]]
 +
* [[2.5.1.42-RXN]]
 +
* [[RXN-10625]]
 +
* [[RXN-11486]]
 +
* [[RXN-11488]]
 +
* [[RXN-13323]]
 +
* [[RXN-14929]]
 +
* [[RXN-17480]]
 +
* [[RXN-3701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7663]]
 +
* [[RXN-7673]]
 +
* [[RXN-8788]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
+
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 +
* [[GGPS]]
 +
* [[RXN-3701]]
 +
* [[RXN-7658]]
 +
* [[RXN-7673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine}}
+
{{#set: common-name=geranylgeranyl diphosphate}}
{{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}}
+
{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
{{#set: molecular-weight=1146.922}}
+
{{#set: molecular-weight=447.424}}

Revision as of 09:22, 27 August 2019

Metabolite GERANYLGERANYL-PP

  • common-name:
    • geranylgeranyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • oinneunvozhbox-qircyjposa-k
  • molecular-weight:
    • 447.424

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality