Difference between revisions of "TRPIAACAT-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13652 CPDMETA-13652] ==
+== Pathway TRPIAACAT-PWY ==
+* taxonomic-range:
+** tax-183924
+** tax-1224
 * common-name:
-** raucaffrinoline
+** indole-3-acetate biosynthesis vi (bacteria)
-* smiles:
+== Reaction(s) found ==
-** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ximpcxfldskalh-vqhwpedhsa-n
+* [None4.1.1.74-RXN 4.1.1.74-RXN]
-* molecular-weight:
+* [NoneINDOLE-3-ACETALDEHYDE-OXIDASE-RXN INDOLE-3-ACETALDEHYDE-OXIDASE-RXN]
-** 352.432
+{{#set: taxonomic-range=tax-183924|tax-1224}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=indole-3-acetate biosynthesis vi (bacteria)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-12673]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=raucaffrinoline}}
-{{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}}
-{{#set: molecular-weight=352.432}}