Difference between revisions of "TRPIAACAT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Ligase-L-lysine DNA-Ligase-L-lysine] == * common-name: ** a [dna ligase]-l-lysine == Reacti...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13652 CPDMETA-13652] == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13652 CPDMETA-13652] == |
* common-name: | * common-name: | ||
− | ** | + | ** raucaffrinoline |
+ | * smiles: | ||
+ | ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) | ||
+ | * inchi-key: | ||
+ | ** ximpcxfldskalh-vqhwpedhsa-n | ||
+ | * molecular-weight: | ||
+ | ** 352.432 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12673]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=raucaffrinoline}} |
+ | {{#set: inchi-key=inchikey=ximpcxfldskalh-vqhwpedhsa-n}} | ||
+ | {{#set: molecular-weight=352.432}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPDMETA-13652
- common-name:
- raucaffrinoline
- smiles:
- cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6)))))
- inchi-key:
- ximpcxfldskalh-vqhwpedhsa-n
- molecular-weight:
- 352.432