Difference between revisions of "TRYPTAMINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05429 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ACID-PHOSPHATASE-RXN *...") |
(Created page with "Category:metabolite == Metabolite TRYPTAMINE == * common-name: ** tryptamine * smiles: ** c([n+])cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** apjydqyyacxcrm-uhfffaoysa-o * molec...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite TRYPTAMINE == |
| − | + | * common-name: | |
| − | * [ | + | ** tryptamine |
| − | == | + | * smiles: |
| − | * | + | ** c([n+])cc1(=cnc2(c=cc=cc1=2)) |
| − | + | * inchi-key: | |
| − | ** | + | ** apjydqyyacxcrm-uhfffaoysa-o |
| − | * | + | * molecular-weight: |
| − | + | ** 161.226 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN-1401]] |
| − | * [[ | + | * [[STRICTOSIDINE-SYNTHASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | {{#set: common-name=tryptamine}} |
| − | + | {{#set: inchi-key=inchikey=apjydqyyacxcrm-uhfffaoysa-o}} | |
| − | + | {{#set: molecular-weight=161.226}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite TRYPTAMINE
- common-name:
- tryptamine
- smiles:
- c([n+])cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- apjydqyyacxcrm-uhfffaoysa-o
- molecular-weight:
- 161.226
