Difference between revisions of "TRYPTAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite Cytidine-32-tRNAs == * common-name: ** a cytidine 32 in trna == Reaction(s) known to consume the compound == * RXN-11866 == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19158 ==
+
== Metabolite Cytidine-32-tRNAs ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-hexadecenoyl-coa
+
** a cytidine 32 in trna
* smiles:
 
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jdnargywmlyada-mdmkaecgsa-j
 
* molecular-weight:
 
** 1013.883
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17791]]
+
* [[RXN-11866]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
+
{{#set: common-name=a cytidine 32 in trna}}
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
 
{{#set: molecular-weight=1013.883}}
 

Revision as of 13:10, 14 January 2021

Metabolite Cytidine-32-tRNAs

  • common-name:
    • a cytidine 32 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality