Difference between revisions of "TTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...")
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytochromes-C-Reduced ==
+
== Metabolite CPD-10814 ==
 
* common-name:
 
* common-name:
** a reduced c-type cytochrome
+
** glycyl-l-proline
 +
* smiles:
 +
** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
 +
* inchi-key:
 +
** kznqnbzmbzjqjo-yfkpbyrvsa-n
 +
* molecular-weight:
 +
** 172.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.10.2.2-RXN]]
+
* [[RXN0-6988]]
* [[CYTOCHROME-C-OXIDASE-RXN]]
 
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
 
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 
* [[RXN-15830]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.10.2.2-RXN]]
 
* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
 
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 
* [[RXN-14107]]
 
* [[RXN-15816]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced c-type cytochrome}}
+
{{#set: common-name=glycyl-l-proline}}
 +
{{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}}
 +
{{#set: molecular-weight=172.183}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-10814

  • common-name:
    • glycyl-l-proline
  • smiles:
    • c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
  • inchi-key:
    • kznqnbzmbzjqjo-yfkpbyrvsa-n
  • molecular-weight:
    • 172.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality