Difference between revisions of "TTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10814 == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) * inchi-key: ** kznqnbzmbzjqjo-yfkpbyrvsa-n...") |
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TTP == |
* common-name: | * common-name: | ||
− | ** | + | ** dttp |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nhvnxkfizysceb-xlpzgreqsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 478.139 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN0- | + | * [[DTTGY]] |
+ | * [[DTTPtm]] | ||
+ | * [[DTTUP]] | ||
+ | * [[RXN-14200]] | ||
+ | * [[RXN0-5107]] | ||
+ | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ATDTD]] | ||
+ | * [[ATDTDm]] | ||
+ | * [[DTDPKIN-RXN]] | ||
+ | * [[DTTPtm]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dttp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=478.139}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TTP
- common-name:
- dttp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
- inchi-key:
- nhvnxkfizysceb-xlpzgreqsa-j
- molecular-weight:
- 478.139