Difference between revisions of "TTP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11727 RXN-11727] == * direction: ** left-to-right * common-name: ** sulfopropanediol 3-dehydrog...") |
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite TTP == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dttp |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) |
| − | == | + | * inchi-key: |
| − | + | ** nhvnxkfizysceb-xlpzgreqsa-j | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 478.139 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[DTTGY]] |
| − | + | * [[DTTPtm]] | |
| − | * [[ | + | * [[DTTUP]] |
| − | + | * [[RXN-14200]] | |
| − | == | + | * [[RXN0-5107]] |
| − | * | + | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[ATDTD]] |
| − | + | * [[ATDTDm]] | |
| − | + | * [[DTDPKIN-RXN]] | |
| − | + | * [[DTTPtm]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: common-name= | + | {{#set: common-name=dttp}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}} |
| − | {{#set: | + | {{#set: molecular-weight=478.139}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TTP
- common-name:
- dttp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
- inchi-key:
- nhvnxkfizysceb-xlpzgreqsa-j
- molecular-weight:
- 478.139
