Difference between revisions of "TTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1G-332 == * common-name: ** 2-carboxy-cerotoyl-coa * smiles: ** ccccccccccccccccccccccccc(c([o-])=o)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(...")
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1G-332 ==
+
== Metabolite TTP ==
 
* common-name:
 
* common-name:
** 2-carboxy-cerotoyl-coa
+
** dttp
 
* smiles:
 
* smiles:
** ccccccccccccccccccccccccc(c([o-])=o)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
 
* inchi-key:
 
* inchi-key:
** vuydekmwdhlssi-rvnpwdolsa-i
+
** nhvnxkfizysceb-xlpzgreqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1185.185
+
** 478.139
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DTTGY]]
 +
* [[DTTPtm]]
 +
* [[DTTUP]]
 +
* [[RXN-14200]]
 +
* [[RXN0-5107]]
 +
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-4355]]
+
* [[ATDTD]]
 +
* [[ATDTDm]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTTPtm]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-cerotoyl-coa}}
+
{{#set: common-name=dttp}}
{{#set: inchi-key=inchikey=vuydekmwdhlssi-rvnpwdolsa-i}}
+
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
{{#set: molecular-weight=1185.185}}
+
{{#set: molecular-weight=478.139}}

Latest revision as of 11:17, 18 March 2021

Metabolite TTP

  • common-name:
    • dttp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
  • inchi-key:
    • nhvnxkfizysceb-xlpzgreqsa-j
  • molecular-weight:
    • 478.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality