Difference between revisions of "TTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...") |
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TTP == |
* common-name: | * common-name: | ||
− | ** | + | ** dttp |
+ | * smiles: | ||
+ | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) | ||
+ | * inchi-key: | ||
+ | ** nhvnxkfizysceb-xlpzgreqsa-j | ||
+ | * molecular-weight: | ||
+ | ** 478.139 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DTTGY]] |
− | * [[ | + | * [[DTTPtm]] |
− | * [[ | + | * [[DTTUP]] |
− | * [[ | + | * [[RXN-14200]] |
− | * [[ | + | * [[RXN0-5107]] |
− | * [[RXN | + | * [[THYMIDINE-TRIPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ATDTD]] |
− | * [[ | + | * [[ATDTDm]] |
− | * [[ | + | * [[DTDPKIN-RXN]] |
− | * [[ | + | * [[DTTPtm]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dttp}} |
+ | {{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}} | ||
+ | {{#set: molecular-weight=478.139}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite TTP
- common-name:
- dttp
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
- inchi-key:
- nhvnxkfizysceb-xlpzgreqsa-j
- molecular-weight:
- 478.139