Difference between revisions of "TTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519] == * direction: ** reversible * common-name: ** peroxisomal 3,2-trans-enoyl-co...")
 
(Created page with "Category:metabolite == Metabolite TTP == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: **...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519] ==
+
== Metabolite TTP ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** peroxisomal 3,2-trans-enoyl-coa isomerase
+
** dttp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/5.3.3.8 ec-5.3.3.8]
+
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
== Reaction formula ==
+
* inchi-key:
* 1 [[trans-2-cis-5-dienoyl-CoA]][c] '''<=>''' 1 [[trans-3-cis-5-dienoyl-CoA]][c]
+
** nhvnxkfizysceb-xlpzgreqsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11169]]
+
** 478.139
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[DTTGY]]
* Gene: [[SJ07211]]
+
* [[DTTPtm]]
** Category: [[annotation]]
+
* [[DTTUP]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14200]]
== Pathway(s) ==
+
* [[RXN0-5107]]
* [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837]
+
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
** '''4''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[ATDTD]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATDTDm]]
== External links  ==
+
* [[DTDPKIN-RXN]]
{{#set: direction=reversible}}
+
* [[DTTPtm]]
{{#set: common-name=peroxisomal 3,2-trans-enoyl-coa isomerase}}
+
== Reaction(s) of unknown directionality ==
{{#set: ec-number=ec-5.3.3.8}}
+
{{#set: common-name=dttp}}
{{#set: nb gene associated=2}}
+
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
{{#set: nb pathway associated=1}}
+
{{#set: molecular-weight=478.139}}
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite TTP

  • common-name:
    • dttp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
  • inchi-key:
    • nhvnxkfizysceb-xlpzgreqsa-j
  • molecular-weight:
    • 478.139

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality