Difference between revisions of "TYR-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17386 == * common-name: ** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)c...")
(Created page with "Category:metabolite == Metabolite TYR-tRNAs == * common-name: ** a trnatyr == Reaction(s) known to consume the compound == * TYROSINE--TRNA-LIGASE-RXN == Reaction(s) k...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17386 ==
+
== Metabolite TYR-tRNAs ==
 
* common-name:
 
* common-name:
** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
+
** a trnatyr
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** nvowzibkqiwtdg-aducosnasa-j
 
* molecular-weight:
 
** 1100.019
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16135]]
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16134]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa}}
+
{{#set: common-name=a trnatyr}}
{{#set: inchi-key=inchikey=nvowzibkqiwtdg-aducosnasa-j}}
 
{{#set: molecular-weight=1100.019}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite TYR-tRNAs

  • common-name:
    • a trnatyr

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality