Difference between revisions of "TYR-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1) * inchi-key: ** hxxfsf...")
(Created page with "Category:metabolite == Metabolite TYR-tRNAs == * common-name: ** a trnatyr == Reaction(s) known to consume the compound == * TYROSINE--TRNA-LIGASE-RXN == Reaction(s) k...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-4 ==
+
== Metabolite TYR-tRNAs ==
 
* common-name:
 
* common-name:
** β-l-galactose 1-phosphate
+
** a trnatyr
* smiles:
 
** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
 
* inchi-key:
 
** hxxfsfrbohsimq-sxuwkvjysa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNQT-4142]]
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN4FS-12]]
 
* [[RXN4FS-13]]
 
* [[RXNQT-4141]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-l-galactose 1-phosphate}}
+
{{#set: common-name=a trnatyr}}
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-sxuwkvjysa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite TYR-tRNAs

  • common-name:
    • a trnatyr

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality