Difference between revisions of "TYR-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-4 == * common-name: ** β-l-galactose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1) * inchi-key: ** hxxfsf...") |
(Created page with "Category:metabolite == Metabolite O-phospho-tau-proteins == * common-name: ** an o-phospho-tau protein == Reaction(s) known to consume the compound == * TAU-PROTEIN-KINA...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite O-phospho-tau-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an o-phospho-tau protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TAU-PROTEIN-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TAU-PROTEIN-KINASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an o-phospho-tau protein}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite O-phospho-tau-proteins
- common-name:
- an o-phospho-tau protein
