Difference between revisions of "TYRFUMCAT-PWY"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUTP DUTP] ==
+== Pathway PWY-6193 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** dutp
+** 3-chlorocatechol degradation ii (ortho)
-* smiles:
+== Reaction(s) found ==
-** c(c2(c(cc(n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ahcymluzirlxaa-shyzeuofsa-j
+* [NoneMALEYLACETATE-REDUCTASE-RXN MALEYLACETATE-REDUCTASE-RXN]
-* molecular-weight:
+* [NoneRXN-9867 RXN-9867]
-** 464.112
+* [NoneRXN-10087 RXN-10087]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-9860 RXN-9860]
-* [[DUTCP]]
+{{#set: taxonomic-range=tax-2}}
-* [[DUTNH]]
+{{#set: common-name=3-chlorocatechol degradation ii (ortho)}}
-* [[DUTP-PYROP-RXN]]
+{{#set: nb reaction found=1}}
-* [[DUTUP]]
+{{#set: completion rate=0.2}}
-* [[RXN-14199]]
+{{#set: nb total reaction=5}}
-* [[RXN-14219]]
-== Reaction(s) known to produce the compound ==
-* [[ATDUD]]
-* [[ATDUDm]]
-* [[DUDPKIN-RXN]]
-* [[RXN0-724]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=dutp}}
-{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
-{{#set: molecular-weight=464.112}}