Difference between revisions of "Tetradec-2-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite Tetradec-2-enoyl-ACPs == * common-name: ** a trans tetradec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9538...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9872 ==
+
== Metabolite Tetradec-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+
** a trans tetradec-2-enoyl-[acp]
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** glnrsjsltucxtp-iqsnhbbhsa-n
 
* molecular-weight:
 
** 767.229
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9538]]
 +
* [[RXN-9662]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9242]]
+
* [[RXN-9537]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a trans tetradec-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
 
{{#set: molecular-weight=767.229}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Tetradec-2-enoyl-ACPs

  • common-name:
    • a trans tetradec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans tetradec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.