Difference between revisions of "Thi-S"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...") |
(Created page with "Category:metabolite == Metabolite Thi-S == * common-name: ** a this sulfur-carrier protein == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Thi-S == |
* common-name: | * common-name: | ||
− | ** | + | ** a this sulfur-carrier protein |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[THIAZOLSYN2-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a this sulfur-carrier protein}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Thi-S
- common-name:
- a this sulfur-carrier protein