Difference between revisions of "Thi-S"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-1084 == * common-name: ** perillyl aldehyde == Reaction(s) known to consume the compound == * RXN-14280 == Reaction(s) known to p...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1084 == |
* common-name: | * common-name: | ||
− | ** | + | ** perillyl aldehyde |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14280]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=perillyl aldehyde}} |
− | |||
− |
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-1084
- common-name:
- perillyl aldehyde