Difference between revisions of "Thiocarboxyadenylated-ThiS-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite Thiocarboxyadenylated-ThiS-Proteins == * common-name: ** a thiocarboxy-[this-protein] == Reaction(s) known to consume the compound == * [...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17324 ==
+
== Metabolite Thiocarboxyadenylated-ThiS-Proteins ==
 
* common-name:
 
* common-name:
** 3-oxo adrenoyl-coa
+
** a thiocarboxy-[this-protein]
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vmajwsswcpbijy-kpovblhlsa-j
 
* molecular-weight:
 
** 1091.996
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16112]]
+
* [[THIAZOLSYN2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=a thiocarboxy-[this-protein]}}
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
 
{{#set: molecular-weight=1091.996}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Thiocarboxyadenylated-ThiS-Proteins

  • common-name:
    • a thiocarboxy-[this-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a thiocarboxy-[this-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.