Difference between revisions of "Thiocarboxylated-MPT-synthases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Long-Chain-Acyl-CoAs == * common-name: ** a long-chain acyl-coa == Reaction(s) known to consume the compound == * 2.3.1.42-RXN * 2....")
(Created page with "Category:metabolite == Metabolite CPD-15668 == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Long-Chain-Acyl-CoAs ==
+
== Metabolite CPD-15668 ==
 
* common-name:
 
* common-name:
** a long-chain acyl-coa
+
** 4-cis-undecenoyl-coa
 +
* smiles:
 +
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** afmmiiqkxqnedn-nsdzghcesa-j
 +
* molecular-weight:
 +
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.42-RXN]]
+
* [[RXN-14775]]
* [[2.3.1.75-RXN]]
 
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 
* [[RXN-12639]]
 
* [[RXN-16066]]
 
* [[RXN-16395]]
 
* [[RXN-9918]]
 
* [[RXNQT-4193]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16066]]
+
* [[RXN-14774]]
* [[RXN-7904]]
 
* [[RXN-9918]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a long-chain acyl-coa}}
+
{{#set: common-name=4-cis-undecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-nsdzghcesa-j}}
 +
{{#set: molecular-weight=929.765}}

Revision as of 11:18, 15 January 2021

Metabolite CPD-15668

  • common-name:
    • 4-cis-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-nsdzghcesa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality