Difference between revisions of "Thiocarboxylated-MPT-synthases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA == * common-name: ** (s)-3-hydroxy-3-methylglutaryl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c...")
(Created page with "Category:metabolite == Metabolite ISOBUTANOL == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxekiibdnhejcq-uhfffaoysa-n * molecular-weight: ** 74.122...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-3-METHYL-GLUTARYL-COA ==
+
== Metabolite ISOBUTANOL ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-3-methylglutaryl-coa
+
** isobutanol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(c)(o)cc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)co
 
* inchi-key:
 
* inchi-key:
** cabvtrnmfuvudm-vrhqgpglsa-i
+
** zxekiibdnhejcq-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 906.621
+
** 74.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.34-RXN]]
+
* [[RXN-7657]]
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.34-RXN]]
+
* [[RXN-7657]]
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-3-methylglutaryl-coa}}
+
{{#set: common-name=isobutanol}}
{{#set: inchi-key=inchikey=cabvtrnmfuvudm-vrhqgpglsa-i}}
+
{{#set: inchi-key=inchikey=zxekiibdnhejcq-uhfffaoysa-n}}
{{#set: molecular-weight=906.621}}
+
{{#set: molecular-weight=74.122}}

Revision as of 13:12, 14 January 2021

Metabolite ISOBUTANOL

  • common-name:
    • isobutanol
  • smiles:
    • cc(c)co
  • inchi-key:
    • zxekiibdnhejcq-uhfffaoysa-n
  • molecular-weight:
    • 74.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality