Difference between revisions of "Thiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
(Created page with "Category:metabolite == Metabolite Thiols == * common-name: ** a thiol == Reaction(s) known to consume the compound == * THIOL-S-METHYLTRANSFERASE-RXN == Reaction(s) kn...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Thiols == |
* common-name: | * common-name: | ||
− | ** | + | ** a thiol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[THIOL-S-METHYLTRANSFERASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15582]] |
− | * [[ | + | * [[RXN-6763]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a thiol}} |
− | |||
− |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite Thiols
- common-name:
- a thiol