Difference between revisions of "Thiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
(Created page with "Category:gene == Gene SJ19385 == * transcription-direction: ** negative * right-end-position: ** 52622 * left-end-position: ** 23234 * centisome-position: ** 10.215666...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ19385 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** negative |
| − | * | + | * right-end-position: |
| − | ** | + | ** 52622 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 23234 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 10.215666 |
| − | == Reaction(s) | + | == Organism(s) associated with this gene == |
| − | * [[ | + | * [[S.japonica_carotenoid_curated]] |
| − | * [[ | + | == Reaction(s) associated == |
| − | + | * [[RXN-15556]] | |
| − | * [[ | + | ** Category: [[orthology]] |
| − | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
| − | == | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
| − | {{#set: | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | ** Category: [[orthology]] |
| + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
| + | == Pathway(s) associated == | ||
| + | * [[PWY-7511]] | ||
| + | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
| + | {{#set: transcription-direction=negative}} | ||
| + | {{#set: right-end-position=52622}} | ||
| + | {{#set: left-end-position=23234}} | ||
| + | {{#set: centisome-position=10.215666 }} | ||
| + | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
| + | {{#set: nb reaction associated=2}} | ||
| + | {{#set: nb pathway associated=1}} | ||
Revision as of 14:53, 5 January 2021
Contents
Gene SJ19385
- transcription-direction:
- negative
- right-end-position:
- 52622
- left-end-position:
- 23234
- centisome-position:
- 10.215666
Organism(s) associated with this gene
Reaction(s) associated
- RXN-15556
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
- UBIQUITIN--PROTEIN-LIGASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7511
- 7 reactions found over 9 reactions in the full pathway
