Difference between revisions of "Thiopurines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * smiles: ** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c * inchi-k...")
(Created page with "Category:metabolite == Metabolite Thiopurines == * common-name: ** a thiopurine == Reaction(s) known to consume the compound == * THIOPURINE-S-METHYLTRANSFERASE-RXN ==...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FARNESYL-PP ==
+
== Metabolite Thiopurines ==
 
* common-name:
 
* common-name:
** (2e,6e)-farnesyl diphosphate
+
** a thiopurine
* smiles:
 
** cc(=cccc(=cccc(=ccop(op([o-])(=o)[o-])(=o)[o-])c)c)c
 
* inchi-key:
 
** vwfjdquyciwhtn-yfvjmotdsa-k
 
* molecular-weight:
 
** 379.306
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.58-RXN]]
+
* [[THIOPURINE-S-METHYLTRANSFERASE-RXN]]
* [[FARNESYLTRANSTRANSFERASE-RXN]]
 
* [[GGPS]]
 
* [[HEMEOSYN-RXN]]
 
* [[RXN-11963]]
 
* [[RXN-12263]]
 
* [[RXN-13162]]
 
* [[RXN-17573]]
 
* [[RXN-8999]]
 
* [[RXN-9969]]
 
* [[RXN0-5180]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.58-RXN]]
 
* [[FPPS]]
 
* [[FPPSYN-RXN]]
 
* [[RXN-11963]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,6e)-farnesyl diphosphate}}
+
{{#set: common-name=a thiopurine}}
{{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}
 
{{#set: molecular-weight=379.306}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Thiopurines

  • common-name:
    • a thiopurine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality