Difference between revisions of "Trans-3-enoyl-CoAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...")
(Created page with "Category:metabolite == Metabolite CPD-35 == * common-name: ** 4-acetamidobutanoate * smiles: ** cc(=o)ncccc(=o)[o-] * inchi-key: ** uztfmubkzqvklk-uhfffaoysa-m * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-277 ==
+
== Metabolite CPD-35 ==
 
* common-name:
 
* common-name:
** 3-fumarylpyruvate
+
** 4-acetamidobutanoate
 
* smiles:
 
* smiles:
** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o
+
** cc(=o)ncccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** azcflhzufanaor-owojbtedsa-l
+
** uztfmubkzqvklk-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 184.105
+
** 144.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10445]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-37]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-fumarylpyruvate}}
+
{{#set: common-name=4-acetamidobutanoate}}
{{#set: inchi-key=inchikey=azcflhzufanaor-owojbtedsa-l}}
+
{{#set: inchi-key=inchikey=uztfmubkzqvklk-uhfffaoysa-m}}
{{#set: molecular-weight=184.105}}
+
{{#set: molecular-weight=144.15}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-35

  • common-name:
    • 4-acetamidobutanoate
  • smiles:
    • cc(=o)ncccc(=o)[o-]
  • inchi-key:
    • uztfmubkzqvklk-uhfffaoysa-m
  • molecular-weight:
    • 144.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality