Difference between revisions of "Trans-3-enoyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
(Created page with "Category:metabolite == Metabolite Trans-3-enoyl-CoAs == * common-name: ** a (3e)-alkan-3-enoyl-coa == Reaction(s) known to consume the compound == * RXN-7836 == Reacti...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Trans-3-enoyl-CoAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3e)-alkan-3-enoyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7836]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12521]] | ||
| + | * [[RXN-7835]] | ||
| + | * [[RXN-7836]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3e)-alkan-3-enoyl-coa}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Trans-3-enoyl-CoAs
- common-name:
- a (3e)-alkan-3-enoyl-coa
