Difference between revisions of "Trans-3-enoyl-CoAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19492 == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])=o * inchi-key: ** ouglpihdpbrsid-uhfffaoysa...") |
(Created page with "Category:metabolite == Metabolite Trans-3-enoyl-CoAs == * common-name: ** a (3e)-alkan-3-enoyl-coa == Reaction(s) known to consume the compound == * RXN-7836 == Reacti...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Trans-3-enoyl-CoAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a (3e)-alkan-3-enoyl-coa |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7836]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12521]] |
+ | * [[RXN-7835]] | ||
+ | * [[RXN-7836]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a (3e)-alkan-3-enoyl-coa}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Trans-3-enoyl-CoAs
- common-name:
- a (3e)-alkan-3-enoyl-coa