Difference between revisions of "Trans-D2-decenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...") |
(Created page with "Category:metabolite == Metabolite Trans-D2-decenoyl-ACPs == * common-name: ** a (2e)-dec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9530 * R...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Trans-D2-decenoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (2e)-dec-2-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9530]] |
| + | * [[RXN-9660]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9655]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (2e)-dec-2-enoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Trans-D2-decenoyl-ACPs
- common-name:
- a (2e)-dec-2-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (2e)-dec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
