Difference between revisions of "Trans-D2-hexacos-2-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BUTYRYL-COA == * common-name: ** butanoyl-coa * smiles: ** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
(Created page with "Category:metabolite == Metabolite Trans-D2-hexacos-2-enoyl-ACPs == * common-name: ** a trans-hexacos-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BUTYRYL-COA ==
+
== Metabolite Trans-D2-hexacos-2-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** butanoyl-coa
+
** a trans-hexacos-2-enoyl-[acp]
* smiles:
 
** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** crfngmnykdxrtn-hdrjhvaisa-j
 
* molecular-weight:
 
** 833.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACACT2h]]
+
* [[RXN-10062]]
* [[ACOA40OR]]
 
* [[ACOAD1f]]
 
* [[RXN-12565]]
 
* [[RXN-13029]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOAD1f]]
+
* [[RXN-10061]]
* [[ACOAR1h]]
 
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[RXN-12558]]
 
* [[RXN-13029]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=butanoyl-coa}}
+
{{#set: common-name=a trans-hexacos-2-enoyl-[acp]}}
{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
 
{{#set: molecular-weight=833.593}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Trans-D2-hexacos-2-enoyl-ACPs

  • common-name:
    • a trans-hexacos-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-hexacos-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.