Difference between revisions of "Trans-D3-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
(Created page with "Category:metabolite == Metabolite OHyWstar-tRNA == * common-name: ** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
+
== Metabolite OHyWstar-tRNA ==
 
* common-name:
 
* common-name:
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
+
** 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe
* smiles:
 
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
* inchi-key:
 
** naqghjtuzrhgac-lbgugvgysa-j
 
* molecular-weight:
 
** 450.255
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AIAL]]
+
* [[RXN-14539]]
* [[AICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AIAL]]
 
* [[AICARSYN-RXN]]
 
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
+
{{#set: common-name=7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
 
{{#set: molecular-weight=450.255}}
 

Revision as of 08:24, 15 March 2021

Metabolite OHyWstar-tRNA

  • common-name:
    • 7-(2-hydroxy-3-amino-3-carboxypropyl)-wyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality