Difference between revisions of "Trans-D3-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D5-dodecenoyl-ACPs == * common-name: ** a (3e,5z)-dodeca-3,5-dienoyl-[acp] == Reaction(s) known to consume the compound == *...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEOYL-COA ==
+
== Metabolite Trans-D3-cis-D5-dodecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** oleoyl-coa
+
** a (3e,5z)-dodeca-3,5-dienoyl-[acp]
* smiles:
 
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xduhqpoxluavee-bpmmelmssa-j
 
* molecular-weight:
 
** 1027.953
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13322]]
+
* [[RXN0-2145]]
* [[RXN-15036]]
 
* [[RXN-15043]]
 
* [[RXN-15044]]
 
* [[RXN-15045]]
 
* [[RXN-15090]]
 
* [[RXN-17775]]
 
* [[RXN-9601]]
 
* [[RXN-9666]]
 
* [[RXN-9670]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.19.1-RXN]]
+
* [[RXN0-2144]]
* [[RXN-15036]]
 
* [[RXN-9644]]
 
* [[RXN-9670]]
 
* [[RXN0-7239]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleoyl-coa}}
+
{{#set: common-name=a (3e,5z)-dodeca-3,5-dienoyl-[acp]}}
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
 
{{#set: molecular-weight=1027.953}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Trans-D3-cis-D5-dodecenoyl-ACPs

  • common-name:
    • a (3e,5z)-dodeca-3,5-dienoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3e,5z)-dodeca-3,5-dienoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.