Difference between revisions of "Trans-D3-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11525 == * transcription-direction: ** positive * right-end-position: ** 297608 * left-end-position: ** 287212 * centisome-position: ** 77.30333...")
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11525 ==
+
== Metabolite OLEOYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** oleoyl-coa
−
* right-end-position:
+
* smiles:
−
** 297608
+
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 287212
+
** xduhqpoxluavee-bpmmelmssa-j
−
* centisome-position:
+
* molecular-weight:
−
** 77.30333   
+
** 1027.953
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13322]]
−
== Reaction(s) associated ==
+
* [[RXN-15036]]
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-15043]]
−
** Category: [[annotation]]
+
* [[RXN-15044]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15045]]
−
* [[RXN-17203]]
+
* [[RXN-15090]]
−
** Category: [[annotation]]
+
* [[RXN-17775]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9601]]
−
* [[RXN-18301]]
+
* [[RXN-9666]]
−
** Category: [[annotation]]
+
* [[RXN-9670]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-18303]]
+
* [[1.14.19.1-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-15036]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9644]]
−
== Pathway(s) associated ==
+
* [[RXN-9670]]
−
* [[PWY-7840]]
+
* [[RXN0-7239]]
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
{{#set: transcription-direction=positive}}
+
{{#set: common-name=oleoyl-coa}}
−
{{#set: right-end-position=297608}}
+
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
−
{{#set: left-end-position=287212}}
+
{{#set: molecular-weight=1027.953}}
−
{{#set: centisome-position=77.30333    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite OLEOYL-COA

  • common-name:
    • oleoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xduhqpoxluavee-bpmmelmssa-j
  • molecular-weight:
    • 1027.953

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Trans-D3-cis-D5-dodecenoyl-ACPs&oldid=45614"