Difference between revisions of "Trans-D3-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OLEOYL-COA ==
+
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
 
* common-name:
 
* common-name:
** oleoyl-coa
+
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
 
* inchi-key:
 
* inchi-key:
** xduhqpoxluavee-bpmmelmssa-j
+
** naqghjtuzrhgac-lbgugvgysa-j
 
* molecular-weight:
 
* molecular-weight:
** 1027.953
+
** 450.255
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13322]]
+
* [[AIAL]]
* [[RXN-15036]]
+
* [[AICARSYN-RXN]]
* [[RXN-15043]]
 
* [[RXN-15044]]
 
* [[RXN-15045]]
 
* [[RXN-15090]]
 
* [[RXN-17775]]
 
* [[RXN-9601]]
 
* [[RXN-9666]]
 
* [[RXN-9670]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.19.1-RXN]]
+
* [[AIAL]]
* [[RXN-15036]]
+
* [[AICARSYN-RXN]]
* [[RXN-9644]]
+
* [[SAICARSYN-RXN]]
* [[RXN-9670]]
 
* [[RXN0-7239]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oleoyl-coa}}
+
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
+
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
{{#set: molecular-weight=1027.953}}
+
{{#set: molecular-weight=450.255}}

Revision as of 14:53, 5 January 2021

Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE

  • common-name:
    • 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
  • smiles:
    • c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
  • inchi-key:
    • naqghjtuzrhgac-lbgugvgysa-j
  • molecular-weight:
    • 450.255

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality