Difference between revisions of "Trans-D3-cis-D5-dodecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE == * common-name: ** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole * smiles: ** c(op([o...")
(Created page with "Category:metabolite == Metabolite 1-7-DIMETHYLXANTHINE == * common-name: ** paraxanthine * smiles: ** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2)) * inchi-key: ** qunwudvfrngtco-uhff...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite P-RIBOSYL-4-SUCCCARB-AMINOIMIDAZOLE ==
+
== Metabolite 1-7-DIMETHYLXANTHINE ==
 
* common-name:
 
* common-name:
−
** 5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole
+
** paraxanthine
 
* smiles:
 
* smiles:
−
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c(n)=c(c(=o)nc(c([o-])=o)cc([o-])=o)n=c1))o2)
+
** cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
 
* inchi-key:
 
* inchi-key:
−
** naqghjtuzrhgac-lbgugvgysa-j
+
** qunwudvfrngtco-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 450.255
+
** 180.166
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[AIAL]]
+
* [[RXN-11520]]
−
* [[AICARSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[AIAL]]
 
−
* [[AICARSYN-RXN]]
 
−
* [[SAICARSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=5'-phosphoribosyl-4-(n-succinocarboxamide)-5-aminoimidazole}}
+
{{#set: common-name=paraxanthine}}
−
{{#set: inchi-key=inchikey=naqghjtuzrhgac-lbgugvgysa-j}}
+
{{#set: inchi-key=inchikey=qunwudvfrngtco-uhfffaoysa-n}}
−
{{#set: molecular-weight=450.255}}
+
{{#set: molecular-weight=180.166}}

Revision as of 15:24, 5 January 2021

Metabolite 1-7-DIMETHYLXANTHINE

  • common-name:
    • paraxanthine
  • smiles:
    • cn2(c=nc1(=c(c(n(c(n1)=o)c)=o)2))
  • inchi-key:
    • qunwudvfrngtco-uhfffaoysa-n
  • molecular-weight:
    • 180.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Trans-D3-cis-D5-dodecenoyl-ACPs&oldid=71668"