Difference between revisions of "Trans-D3-cis-D7-tetradecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...")
(Created page with "Category:metabolite == Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA == * common-name: ** a medium-chain trans-2,3-dehydroacyl-coa == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CONIFERYL-ALDEHYDE ==
+
== Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA ==
 
* common-name:
 
* common-name:
** coniferaldehyde
+
** a medium-chain trans-2,3-dehydroacyl-coa
* smiles:
 
** coc1(=cc(c=cc=o)=cc=c(o)1)
 
* inchi-key:
 
** dkzbbwmurdfhne-nscuhmnnsa-n
 
* molecular-weight:
 
** 178.187
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11734]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1106]]
+
* [[RXN-11734]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferaldehyde}}
+
{{#set: common-name=a medium-chain trans-2,3-dehydroacyl-coa}}
{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
 
{{#set: molecular-weight=178.187}}
 

Revision as of 11:14, 15 January 2021

Metabolite medium-Chain-Trans-23-Dehydroacyl-CoA

  • common-name:
    • a medium-chain trans-2,3-dehydroacyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality